ChemNet > CAS > 52239-63-1 malic acid, compound with 2-(ethylthio)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine (2:1)
52239-63-1 malic acid, compound with 2-(ethylthio)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine (2:1)
उत्पाद का नाम |
malic acid, compound with 2-(ethylthio)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine (2:1) |
अंग्रेजी नाम |
malic acid, compound with 2-(ethylthio)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine (2:1); Thiethylperazine Malate; 2-hydroxybutanedioic acid - 2-(ethylsulfanyl)-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine (2:1) |
आणविक फार्मूला |
C30H41N3O10S2 |
आण्विक वजन |
667.7906 |
InChI |
InChI=1/C22H29N3S2.2C4H6O5/c1-3-26-18-9-10-22-20(17-18)25(19-7-4-5-8-21(19)27-22)12-6-11-24-15-13-23(2)14-16-24;2*5-2(4(8)9)1-3(6)7/h4-5,7-10,17H,3,6,11-16H2,1-2H3;2*2,5H,1H2,(H,6,7)(H,8,9) |
कैस रजिस्टी संख्या |
52239-63-1 |
EINECS |
257-780-2 |
आणविक संरचना |
|
उबलने का समय |
559.8°C at 760 mmHg |
फ्लैश प्वाइंट |
292.4°C |
वाष्प का दबाव |
1.46E-12mmHg at 25°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
|
|